EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H4N2O3 |
| Net Charge | 0 |
| Average Mass | 116.076 |
| Monoisotopic Mass | 116.02219 |
| SMILES | O=C1NC(=O)C(O)N1 |
| InChI | InChI=1S/C3H4N2O3/c6-1-2(7)5-3(8)4-1/h1,6H,(H2,4,5,7,8) |
| InChIKey | WYLUZALOENCNQU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Botryllus schlosseri (ncbitaxon:30301) | - | PubMed (11962238) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxyhydantoin (CHEBI:195336) has functional parent hydantoin (CHEBI:27612) |
| 5-hydroxyhydantoin (CHEBI:195336) has role animal metabolite (CHEBI:75767) |
| 5-hydroxyhydantoin (CHEBI:195336) has role marine metabolite (CHEBI:76507) |
| 5-hydroxyhydantoin (CHEBI:195336) is a imidazolidine-2,4-dione (CHEBI:24628) |
| 5-hydroxyhydantoin (CHEBI:195336) is a organic hydroxy compound (CHEBI:33822) |
| IUPAC Name |
|---|
| 5-hydroxyimidazolidine-2,4-dione |
| Synonym | Source |
|---|---|
| 5-hydroxy-2,4-imidazolidinedione | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 5-Hydroxyhydantoin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:29410-13-7 | ChEBI |
| Citations |
|---|