EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13NO2S |
| Net Charge | 0 |
| Average Mass | 235.308 |
| Monoisotopic Mass | 235.06670 |
| SMILES | CCN1/C(=C/C(C)=O)Sc2ccc(O)cc21 |
| InChI | InChI=1S/C12H13NO2S/c1-3-13-10-7-9(15)4-5-11(10)16-12(13)6-8(2)14/h4-7,15H,3H2,1-2H3/b12-6- |
| InChIKey | GCSZJMUFYOAHFY-SDQBBNPISA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.12.1 (dual-specificity kinase) inhibitor An EC 2.7.12.* [dual-specificity kinases (those acting on Ser/Thr and Tyr residues)] inhibitor that inhibits the action of dual-specificity kinase (EC 2.7.12.1). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| INDY (CHEBI:195332) has role antineoplastic agent (CHEBI:35610) |
| INDY (CHEBI:195332) has role drug metabolite (CHEBI:49103) |
| INDY (CHEBI:195332) has role EC 2.7.12.1 (dual-specificity kinase) inhibitor (CHEBI:195525) |
| INDY (CHEBI:195332) is a benzothiazoles (CHEBI:37947) |
| INDY (CHEBI:195332) is a enone (CHEBI:51689) |
| INDY (CHEBI:195332) is a organic hydroxy compound (CHEBI:33822) |
| Incoming Relation(s) |
| proINDY (CHEBI:195315) has functional parent INDY (CHEBI:195332) |
| IUPAC Name |
|---|
| (1Z)-1-(3-ethyl-5-hydroxy-1,3-benzothiazol-2(3H)-ylidene)propan-2-one |
| Synonyms | Source |
|---|---|
| (1Z)-1-(3-ethyl-5-hydroxy-1,3-benzothiazol-2-ylidene)propan-2-one | PDBeChem |
| (1Z)-1-(3-ethyl-5-hydroxy-2(3H)-benzothiazolylidene)-2-propanone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| EHB | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:1169755-45-6 | ChEBI |
| Citations |
|---|