EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25N5O7S2 |
| Net Charge | 0 |
| Average Mass | 547.615 |
| Monoisotopic Mass | 547.11954 |
| SMILES | [H][C@]12N[C@@]1([H])CN1C3=C(C(=O)C(NCCSSc4ccc([N+](=O)[O-])cc4)=C(C)C3=O)[C@@H](COC(N)=O)[C@]12OC |
| InChI | InChI=1S/C23H25N5O7S2/c1-11-17(25-7-8-36-37-13-5-3-12(4-6-13)28(32)33)20(30)16-14(10-35-22(24)31)23(34-2)21-15(26-21)9-27(23)18(16)19(11)29/h3-6,14-15,21,25-26H,7-10H2,1-2H3,(H2,24,31)/t14-,15+,21+,23-/m1/s1 |
| InChIKey | ZNDJOCJUBZZAMN-USYHLRJESA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BMY-25067 (CHEBI:195316) has functional parent mitomycin C (CHEBI:27504) |
| BMY-25067 (CHEBI:195316) has role antineoplastic agent (CHEBI:35610) |
| BMY-25067 (CHEBI:195316) is a C-nitro compound (CHEBI:35716) |
| BMY-25067 (CHEBI:195316) is a organic disulfide (CHEBI:35489) |
| IUPAC Name |
|---|
| [(1aS,8S,8aR,8bS)-8a-methoxy-5-methyl-6-({2-[(4-nitrophenyl)disulfanyl]ethyl}amino)-4,7-dioxo-1,1a,2,4,7,8,8a,8b-octahydroazirino[2',3':3,4]pyrrolo[1,2-a]indol-8-yl]methyl carbamate |
| Synonyms | Source |
|---|---|
| BMS 181174 | ChEBI |
| BMS-181174 | ChEBI |
| BMS181174 | ChEBI |
| BMY 25067 | ChEBI |
| BMY25067 | ChEBI |
| N-7-(2-(nitrophenyldithio)ethyl)mitomycin C | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US5703111 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:95056-36-3 | ChEBI |
| Citations |
|---|