EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14N2O3 |
| Net Charge | 0 |
| Average Mass | 282.299 |
| Monoisotopic Mass | 282.10044 |
| SMILES | N[C@@H](Cc1ccc2nc3ccccc3c(=O)c2c1)C(=O)O |
| InChI | InChI=1S/C16H14N2O3/c17-12(16(20)21)8-9-5-6-14-11(7-9)15(19)10-3-1-2-4-13(10)18-14/h1-7,12H,8,17H2,(H,18,19)(H,20,21)/t12-/m0/s1 |
| InChIKey | NPALYBYZIAGBTE-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Application: | fluorescent probe A role played by a fluorescent molecular entity used to study the microscopic environment by fluorescence spectroscopy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acridon-2-yl-L-alanine (CHEBI:195314) has role fluorescent probe (CHEBI:39442) |
| acridon-2-yl-L-alanine (CHEBI:195314) is a L-alanine derivative (CHEBI:83943) |
| acridon-2-yl-L-alanine (CHEBI:195314) is a acridone derivatives (CHEBI:61878) |
| acridon-2-yl-L-alanine (CHEBI:195314) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-(9-oxo-9,10-dihydroacridin-2-yl)propanoic acid |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-(9-oxo-10H-acridin-2-yl)propanoic acid | ChEBI |
| 3-(9,10-dihydro-9-oxoacridine-2-yl)-L-alanine | ChEBI |
| 3-(9-oxo-9,10-dihydroacridine-2-yl)alanine | ChEBI |
| 3-(9-oxo-9,10-dihydroacridine-2-yl)-L-alanine | ChEBI |
| Acd | ChEBI |
| acridon-2-ylalanine | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| T7Q | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:854503-32-5 | ChEBI |
| Citations |
|---|