EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26O7 |
| Net Charge | 0 |
| Average Mass | 426.465 |
| Monoisotopic Mass | 426.16785 |
| SMILES | COc1c(CC=C(C)C)c(O)cc2oc3cc(O)c4c(c3c(=O)c12)CC(C(C)(C)O)O4 |
| InChI | InChI=1S/C24H26O7/c1-11(2)6-7-12-14(25)9-17-20(23(12)29-5)21(27)19-13-8-18(24(3,4)28)31-22(13)15(26)10-16(19)30-17/h6,9-10,18,25-26,28H,7-8H2,1-5H3 |
| InChIKey | FDRULGMDTDLXKD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cratoxylum cochinchinense (ncbitaxon:271749) | stem (BTO:0001300) | PubMed (20570298) | |
| Phomopsis sp. (ncbitaxon:1715245) | - | PubMed (33494367) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cratoxylumxanthone D (CHEBI:195295) has role fungal metabolite (CHEBI:76946) |
| cratoxylumxanthone D (CHEBI:195295) has role plant metabolite (CHEBI:76924) |
| cratoxylumxanthone D (CHEBI:195295) has role radical scavenger (CHEBI:48578) |
| cratoxylumxanthone D (CHEBI:195295) is a aromatic ether (CHEBI:35618) |
| cratoxylumxanthone D (CHEBI:195295) is a olefinic compound (CHEBI:78840) |
| cratoxylumxanthone D (CHEBI:195295) is a phenols (CHEBI:33853) |
| cratoxylumxanthone D (CHEBI:195295) is a tertiary alcohol (CHEBI:26878) |
| cratoxylumxanthone D (CHEBI:195295) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 4,8-dihydroxy-2-(2-hydroxypropan-2-yl)-10-methoxy-9-(3-methylbut-2-en-1-yl)-1,2-dihydro-11H-furo[3,2-a]xanthen-11-one |
| Citations |
|---|