EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:195292 - cratoxylumxanthone B
| Formula | C28H32O6 |
| Net Charge | 0 |
| Average Mass | 464.558 |
| Monoisotopic Mass | 464.21989 |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c2c(c(O)c3c(=O)c4cc(O)ccc4oc13)CC(C(C)(C)O)O2 |
| InChI | InChI=1S/C28H32O6/c1-15(2)7-6-8-16(3)9-11-18-26-20(14-22(34-26)28(4,5)32)25(31)23-24(30)19-13-17(29)10-12-21(19)33-27(18)23/h7,9-10,12-13,22,29,31-32H,6,8,11,14H2,1-5H3/b16-9+ |
| InChIKey | NMRLLECQUNBZIH-CXUHLZMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cratoxylum cochinchinense (ncbitaxon:271749) | stem (BTO:0001300) | PubMed (20570298) | |
| Lisotrigona furva (ncbitaxon:398120) | - | PubMed (33387643) | Found in propolis. |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cratoxylumxanthone B (CHEBI:195292) has role animal metabolite (CHEBI:75767) |
| cratoxylumxanthone B (CHEBI:195292) has role plant metabolite (CHEBI:76924) |
| cratoxylumxanthone B (CHEBI:195292) is a olefinic compound (CHEBI:78840) |
| cratoxylumxanthone B (CHEBI:195292) is a organic heterotetracyclic compound (CHEBI:38163) |
| cratoxylumxanthone B (CHEBI:195292) is a phenols (CHEBI:33853) |
| cratoxylumxanthone B (CHEBI:195292) is a tertiary alcohol (CHEBI:26878) |
| cratoxylumxanthone B (CHEBI:195292) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 11-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-4,7-dihydroxy-2-(2-hydroxypropan-2-yl)-2,3-dihydro-5H-furo[3,2-b]xanthen-5-one |
| Citations |
|---|