EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O4 |
| Net Charge | 0 |
| Average Mass | 262.305 |
| Monoisotopic Mass | 262.12051 |
| SMILES | [H][C@@]12Cc3c(ccc(C(C)=O)c3O)O[C@]1(C)OC[C@H]2C |
| InChI | InChI=1S/C15H18O4/c1-8-7-18-15(3)12(8)6-11-13(19-15)5-4-10(9(2)16)14(11)17/h4-5,8,12,17H,6-7H2,1-3H3/t8-,12+,15+/m1/s1 |
| InChIKey | IIAGASOFCPRGKH-XHYYPMHDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria sp. 2508 (ncbitaxon:598750) | - | PubMed (11559170) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xyloketal D (CHEBI:195290) is a methyl ketone (CHEBI:51867) |
| xyloketal D (CHEBI:195290) is a organic heterotricyclic compound (CHEBI:26979) |
| xyloketal D (CHEBI:195290) is a organic hydroxy compound (CHEBI:33822) |
| xyloketal D (CHEBI:195290) is a xyloketal (CHEBI:195287) |
| IUPAC Name |
|---|
| 1-[(3S,3aS,9aS)-5-hydroxy-3,9a-dimethyl-2,3,3a,9a-tetrahydro-4H-furo[2,3-b]chromen-6-yl]ethanone |
| Synonym | Source |
|---|---|
| 1-[(3S,3aS,9aS)-5-hydroxy-3,9a-dimethyl-2,3,3a,9a-tetrahydro-4H-furo[2,3-b][1]benzopyran-6-yl]ethan-1-one | IUPAC |
| Citations |
|---|