EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36O6 |
| Net Charge | 0 |
| Average Mass | 456.579 |
| Monoisotopic Mass | 456.25119 |
| SMILES | [H][C@]12Cc3c(c4c(c5c3O[C@@]3(C)OC[C@H](C)[C@@]3([H])C5)O[C@@]3(C)OC[C@H](C)[C@@]3([H])C4)O[C@@]1(C)OC[C@@H]2C |
| InChI | InChI=1S/C27H36O6/c1-13-10-28-25(4)19(13)7-16-22(31-25)17-8-20-14(2)12-30-27(20,6)33-24(17)18-9-21-15(3)11-29-26(21,5)32-23(16)18/h13-15,19-21H,7-12H2,1-6H3/t13-,14-,15-,19+,20+,21+,25+,26+,27+/m0/s1 |
| InChIKey | HFZTVRRNBDAJIS-PERNPGNGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria sp. 2508 (ncbitaxon:598750) | - | PubMed (11559170) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xyloketal A (CHEBI:195288) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| xyloketal A (CHEBI:195288) is a organic heteroheptacyclic compound (CHEBI:52157) |
| xyloketal A (CHEBI:195288) is a xyloketal (CHEBI:195287) |
| IUPAC Name |
|---|
| (3R,3aR,5aR,8R,8aR,10aR,13R,13aR,15aR)-3,5a,8,10a,13,15a-hexamethyl-2,3,3a,7,8,8a,9,12,13,13a,14,15a-dodecahydro-4H,5aH,10aH-furo[2,3-b]bisfuro[3',2':5,6]pyrano[2,3-f:2',3'-h]chromene |
| Synonyms | Source |
|---|---|
| (3R,3aR,5aR,8R,8aR,10aR,13R,13aR,15aR)-3,5a,8,10a,13,15a-hexamethyl-2,3,3a,7,8,8a,9,12,13,13a,14,15a-dodecahydro-4H,5aH,10aH-trifuro[3,2-e:3,2-e':3,2-e'']benzo[1,6-b:3,2-b':5,4-b'']tripyran | IUPAC |
| (−)-xyloketal A | ChEBI |
| Citations |
|---|