EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28O7 |
| Net Charge | 0 |
| Average Mass | 428.481 |
| Monoisotopic Mass | 428.18350 |
| SMILES | COc1cc2oc3cc(O)c(O)c(CCC(C)(C)O)c3c(=O)c2c(O)c1CC=C(C)C |
| InChI | InChI=1S/C24H28O7/c1-12(2)6-7-13-16(30-5)11-18-20(22(13)27)23(28)19-14(8-9-24(3,4)29)21(26)15(25)10-17(19)31-18/h6,10-11,25-27,29H,7-9H2,1-5H3 |
| InChIKey | HPBDPXPBIKIIJO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cratoxylum cochinchinense (ncbitaxon:271749) | stem (BTO:0001300) | PubMed (20570298) | |
| Cratoxylum pruniflorum (ncbitaxon:1137046) | stem (BTO:0001300) | PubMed (20608716) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cratoxylumxanthone C (CHEBI:195283) has role angiogenesis inhibitor (CHEBI:48422) |
| cratoxylumxanthone C (CHEBI:195283) has role antineoplastic agent (CHEBI:35610) |
| cratoxylumxanthone C (CHEBI:195283) has role antioxidant (CHEBI:22586) |
| cratoxylumxanthone C (CHEBI:195283) has role apoptosis inducer (CHEBI:68495) |
| cratoxylumxanthone C (CHEBI:195283) has role plant metabolite (CHEBI:76924) |
| cratoxylumxanthone C (CHEBI:195283) is a aromatic ether (CHEBI:35618) |
| cratoxylumxanthone C (CHEBI:195283) is a olefinic compound (CHEBI:78840) |
| cratoxylumxanthone C (CHEBI:195283) is a phenols (CHEBI:33853) |
| cratoxylumxanthone C (CHEBI:195283) is a tertiary alcohol (CHEBI:26878) |
| cratoxylumxanthone C (CHEBI:195283) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,6,7-trihydroxy-8-(3-hydroxy-3-methylbutyl)-3-methoxy-2-(3-methylbut-2-en-1-yl)-9H-xanthen-9-one |
| Synonyms | Source |
|---|---|
| pruniflorone R | ChEBI |
| 1,6,7-trihydroxy-2-prenyl-3-methoxy-8-(3-methyl-3-hydroxybutyl)-9H-xanthene-9-one | ChEBI |
| 1,6,7-trihydroxy-2-prenyl-3-methoxy-8-(3-hydroxy-3-methylbutyl)-9H-xanthene-9-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1238102-65-2 | ChEBI |
| Citations |
|---|