EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O5 |
| Net Charge | 0 |
| Average Mass | 346.423 |
| Monoisotopic Mass | 346.17802 |
| SMILES | [H][C@]12Cc3c(cc(O)c4c3O[C@@]3(C)OC[C@H](C)[C@@]3([H])C4)O[C@@]1(C)OC[C@@H]2C |
| InChI | InChI=1S/C20H26O5/c1-10-9-23-20(4)14(10)5-12-16(21)7-17-13(18(12)25-20)6-15-11(2)8-22-19(15,3)24-17/h7,10-11,14-15,21H,5-6,8-9H2,1-4H3/t10-,11-,14+,15+,19+,20+/m0/s1 |
| InChIKey | CCNANHBVUNZCKA-FCOFOHSNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria sp. 2508 (ncbitaxon:598750) | - | PubMed (11559170) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xyloketal B (CHEBI:195282) has role anti-inflammatory agent (CHEBI:67079) |
| xyloketal B (CHEBI:195282) has role antiatherosclerotic agent (CHEBI:145947) |
| xyloketal B (CHEBI:195282) has role antihypertensive agent (CHEBI:35674) |
| xyloketal B (CHEBI:195282) has role neuroprotective agent (CHEBI:63726) |
| xyloketal B (CHEBI:195282) has role radical scavenger (CHEBI:48578) |
| xyloketal B (CHEBI:195282) is a organic heteropentacyclic compound (CHEBI:38164) |
| xyloketal B (CHEBI:195282) is a organic hydroxy compound (CHEBI:33822) |
| xyloketal B (CHEBI:195282) is a xyloketal (CHEBI:195287) |
| IUPAC Name |
|---|
| (3R,3aR,7aR,10R,10aR,12aR)-3,7a,10,12a-tetramethyl-2,3,3a,9,10,10a,11,12a-octahydro-4H,7aH-furo[2,3-b]furo[3',2':5,6]pyrano[2,3-f]chromen-5-ol |
| Synonyms | Source |
|---|---|
| (3R,3aR,7aR,10R,10aR,12aR)-3,7a,10,12a-tetramethyl-2,3,3a,9,10,10a,11,12a-octahydro-4H,7aH-difuro[3,2-e:3,2-e']benzo[1,2-b:5,6-b']dipyran-5-ol | IUPAC |
| (+)-xyloketal B | ChEBI |
| Citations |
|---|