EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O5 |
| Net Charge | 0 |
| Average Mass | 346.423 |
| Monoisotopic Mass | 346.17802 |
| SMILES | [H][C@]12Cc3c(cc(O)c4c3O[C@@]3(C)OC[C@H](C)[C@@]3([H])C4)O[C@@]1(C)OC[C@@H]2C |
| InChI | InChI=1S/C20H26O5/c1-10-9-23-20(4)14(10)5-12-16(21)7-17-13(18(12)25-20)6-15-11(2)8-22-19(15,3)24-17/h7,10-11,14-15,21H,5-6,8-9H2,1-4H3/t10-,11-,14+,15+,19+,20+/m0/s1 |
| InChIKey | CCNANHBVUNZCKA-FCOFOHSNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria sp. 2508 (ncbitaxon:598750) | - | PubMed (11559170) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xyloketal B (CHEBI:195282) has role anti-inflammatory agent (CHEBI:67079) |
| xyloketal B (CHEBI:195282) has role antiatherosclerotic agent (CHEBI:145947) |
| xyloketal B (CHEBI:195282) has role antihypertensive agent (CHEBI:35674) |
| xyloketal B (CHEBI:195282) has role neuroprotective agent (CHEBI:63726) |
| xyloketal B (CHEBI:195282) has role radical scavenger (CHEBI:48578) |
| xyloketal B (CHEBI:195282) is a organic heteropentacyclic compound (CHEBI:38164) |
| xyloketal B (CHEBI:195282) is a organic hydroxy compound (CHEBI:33822) |
| xyloketal B (CHEBI:195282) is a xyloketal (CHEBI:195287) |
| IUPAC Name |
|---|
| (3R,3aR,7aR,10R,10aR,12aR)-3,7a,10,12a-tetramethyl-2,3,3a,9,10,10a,11,12a-octahydro-4H,7aH-furo[2,3-b]furo[3',2':5,6]pyrano[2,3-f]chromen-5-ol |
| Synonyms | Source |
|---|---|
| (3R,3aR,7aR,10R,10aR,12aR)-3,7a,10,12a-tetramethyl-2,3,3a,9,10,10a,11,12a-octahydro-4H,7aH-difuro[3,2-e:3,2-e']benzo[1,2-b:5,6-b']dipyran-5-ol | IUPAC |
| (+)-xyloketal B | ChEBI |
| Citations |
|---|