EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O6 |
| Net Charge | 0 |
| Average Mass | 346.379 |
| Monoisotopic Mass | 346.14164 |
| SMILES | [H][C@@]12OC(=O)/C(=C/O[C@H]3C=C(C)C(=O)O3)[C@]1([H])[C@@H](O)C1=C2C(C)(C)CCC1 |
| InChI | InChI=1S/C19H22O6/c1-9-7-12(24-17(9)21)23-8-11-13-15(20)10-5-4-6-19(2,3)14(10)16(13)25-18(11)22/h7-8,12-13,15-16,20H,4-6H2,1-3H3/b11-8+/t12-,13-,15+,16-/m1/s1 |
| InChIKey | CDBBMEYPRMUMTR-KIKJJFSISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nicotiana tabacum (ncbitaxon:4097) | Root (BTO:0001188) | PubMed (23204500) | |
| Prunus persica (ncbitaxon:3760) | Root (BTO:0001188) | PubMed (37292030) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orobanchol (CHEBI:195254) has functional parent orobanchol ABC-rings (CHEBI:195257) |
| orobanchol (CHEBI:195254) has role plant metabolite (CHEBI:76924) |
| orobanchol (CHEBI:195254) is a indenofuran (CHEBI:149453) |
| orobanchol (CHEBI:195254) is a secondary alcohol (CHEBI:35681) |
| orobanchol (CHEBI:195254) is a strigolactone (CHEBI:68487) |
| IUPAC Name |
|---|
| (3E,3aR,4R,8bR)-4-hydroxy-8,8-dimethyl-3-({[(2R)-4-methyl-5-oxo-2,5-dihydrofuran-2-yl]oxy}methylidene)-3,3a,4,5,6,7,8,8b-octahydro-2H-indeno[1,2-b]furan-2-one |
| UniProt Name | Source |
|---|---|
| orobanchol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00037587 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:220493-65-2 | KNApSAcK |
| Citations |
|---|