EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O3 |
| Net Charge | 0 |
| Average Mass | 114.100 |
| Monoisotopic Mass | 114.03169 |
| SMILES | CC1=CC(O)OC1=O |
| InChI | InChI=1S/C5H6O3/c1-3-2-4(6)8-5(3)7/h2,4,6H,1H3 |
| InChIKey | HQIZYPQNJWENRT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Litsea verticillata (ncbitaxon:1009487) | - | PubMed (15931585) |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxy-3-methylfuran-2(5H)-one (CHEBI:195253) has role anti-HIV agent (CHEBI:64946) |
| 5-hydroxy-3-methylfuran-2(5H)-one (CHEBI:195253) has role plant metabolite (CHEBI:76924) |
| 5-hydroxy-3-methylfuran-2(5H)-one (CHEBI:195253) is a butenolide (CHEBI:50523) |
| 5-hydroxy-3-methylfuran-2(5H)-one (CHEBI:195253) is a secondary allylic alcohol (CHEBI:134396) |
| IUPAC Name |
|---|
| 5-hydroxy-3-methylfuran-2(5H)-one |
| Synonyms | Source |
|---|---|
| 2-hydroxy-4-methyl-2H-furan-5-one | ChEBI |
| 5-hydroxy-3-methyl-2,5-dihydrofuran-2-one | ChEBI |
| 5-hydroxy-3-methyl-2(5H)-furanone | ChEBI |
| UniProt Name | Source |
|---|---|
| 5-hydroxy-3-methylfuran-2(5H)-one | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1280983 | Reaxys |
| CAS:931-23-7 | ChEBI |
| Citations |
|---|