EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3[13C4]H19N3 |
| Net Charge | 0 |
| Average Mass | 149.219 |
| Monoisotopic Mass | 149.17132 |
| SMILES | NCCCN[13CH2][13CH2][13CH2][13CH2]N |
| InChI | InChI=1S/C7H19N3/c8-4-1-2-6-10-7-3-5-9/h10H,1-9H2/i1+1,2+1,4+1,6+1 |
| InChIKey | ATHGHQPFGPMSJY-UIWMGSJQSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spermidine-(butyl-13C4) (CHEBI:195243) is a 13C-modified compound (CHEBI:139357) |
| spermidine-(butyl-13C4) (CHEBI:195243) is a spermidine (CHEBI:16610) |
| IUPAC Name |
|---|
| N-(3-aminopropyl)(13C4)butane-1,4-diamine |
| Synonym | Source |
|---|---|
| N'-(3-aminopropyl)(1,2,3,4-13C4)butane-1,4-diamine | SUBMITTER |
| Citations |
|---|