EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3[13C4]H19N3 |
| Net Charge | 0 |
| Average Mass | 149.219 |
| Monoisotopic Mass | 149.17132 |
| SMILES | NCCCN[13CH2][13CH2][13CH2][13CH2]N |
| InChI | InChI=1S/C7H19N3/c8-4-1-2-6-10-7-3-5-9/h10H,1-9H2/i1+1,2+1,4+1,6+1 |
| InChIKey | ATHGHQPFGPMSJY-UIWMGSJQSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spermidine-(butyl-13C4) (CHEBI:195243) is a 13C-modified compound (CHEBI:139357) |
| spermidine-(butyl-13C4) (CHEBI:195243) is a spermidine (CHEBI:16610) |
| IUPAC Name |
|---|
| N-(3-aminopropyl)(13C4)butane-1,4-diamine |
| Synonym | Source |
|---|---|
| N'-(3-aminopropyl)(1,2,3,4-13C4)butane-1,4-diamine | SUBMITTER |
| Citations |
|---|