EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O |
| Net Charge | 0 |
| Average Mass | 128.215 |
| Monoisotopic Mass | 128.12012 |
| SMILES | CCCC(C)C(=O)CC |
| InChI | InChI=1S/C8H16O/c1-4-6-7(3)8(9)5-2/h7H,4-6H2,1-3H3 |
| InChIKey | MVLRILUUXLBENA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Antilope cervicapra (ncbitaxon:59525) | Urine (NCIT:C13283) | PubMed (20547215) | |
| Eciton burchellii (ncbitaxon:213866) | - | DOI (10.1111/j.1365-3032.2010.00749.x) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | alarm pheromone A pheromone which is released by an organism when damaged by a predator which warns other individuals that there is a danger. mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylheptan-3-one (CHEBI:195232) has role alarm pheromone (CHEBI:72575) |
| 4-methylheptan-3-one (CHEBI:195232) has role flavouring agent (CHEBI:35617) |
| 4-methylheptan-3-one (CHEBI:195232) has role mammalian metabolite (CHEBI:75768) |
| 4-methylheptan-3-one (CHEBI:195232) is a dialkyl ketone (CHEBI:18044) |
| IUPAC Name |
|---|
| 4-methylheptan-3-one |
| Synonyms | Source |
|---|---|
| 4-methyl-3-heptanone | ChEBI |
| ethyl 1-methylbutyl ketone | ChEBI |
| FEMA 4966 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1743841 | Reaxys |
| CAS:6137-11-7 | NIST Chemistry WebBook |
| Citations |
|---|