EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18O2 |
| Net Charge | 0 |
| Average Mass | 194.274 |
| Monoisotopic Mass | 194.13068 |
| SMILES | CCCCCc1cccc(O)c1CO |
| InChI | InChI=1S/C12H18O2/c1-2-3-4-6-10-7-5-8-12(14)11(10)9-13/h5,7-8,13-14H,2-4,6,9H2,1H3 |
| InChIKey | BVZSJLRAINTEAD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria nigripes (ncbitaxon:490159) | - | PubMed (28055210) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxymethyl-3-pentylphenol (CHEBI:195220) has role fungal metabolite (CHEBI:76946) |
| 2-hydroxymethyl-3-pentylphenol (CHEBI:195220) is a aromatic primary alcohol (CHEBI:33857) |
| 2-hydroxymethyl-3-pentylphenol (CHEBI:195220) is a benzyl alcohols (CHEBI:22743) |
| 2-hydroxymethyl-3-pentylphenol (CHEBI:195220) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| (8S)-annullatin E (CHEBI:195221) has functional parent 2-hydroxymethyl-3-pentylphenol (CHEBI:195220) |
| IUPAC Name |
|---|
| 2-(hydroxymethyl)-3-pentylphenol |
| Synonym | Source |
|---|---|
| 2-hydroxy-6-pentylbenzyl alcohol | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-hydroxymethyl-3-pentylphenol | UniProt |
| Citations |
|---|