EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28NO4 |
| Net Charge | +1 |
| Average Mass | 358.458 |
| Monoisotopic Mass | 358.20128 |
| SMILES | COc1ccc(C[C@H]2c3cc(OC)c(OC)cc3CC[NH+]2C)cc1OC |
| InChI | InChI=1S/C21H27NO4/c1-22-9-8-15-12-20(25-4)21(26-5)13-16(15)17(22)10-14-6-7-18(23-2)19(11-14)24-3/h6-7,11-13,17H,8-10H2,1-5H3/p+1/t17-/m0/s1 |
| InChIKey | KGPAYJZAMGEDIQ-KRWDZBQOSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-laudanosine(1+) (CHEBI:195218) is a ammonium ion derivative (CHEBI:35274) |
| (S)-laudanosine(1+) (CHEBI:195218) is a organic cation (CHEBI:25697) |
| (S)-laudanosine(1+) (CHEBI:195218) is conjugate acid of Laudanosine (CHEBI:6389) |
| Incoming Relation(s) |
| Laudanosine (CHEBI:6389) is conjugate base of (S)-laudanosine(1+) (CHEBI:195218) |
| Synonym | Source |
|---|---|
| (S)-laudanosine cation | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (S)-N-methyltetrahydropapaverine | UniProt |
| Citations |
|---|