EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:195185 - gravacridonediol
| Formula | C19H19NO5 |
| Net Charge | 0 |
| Average Mass | 341.363 |
| Monoisotopic Mass | 341.12632 |
| SMILES | Cn1c2ccccc2c(=O)c2c(O)cc3c(c21)CC(C(C)(O)CO)O3 |
| InChI | InChI=1S/C19H19NO5/c1-19(24,9-21)15-7-11-14(25-15)8-13(22)16-17(11)20(2)12-6-4-3-5-10(12)18(16)23/h3-6,8,15,21-22,24H,7,9H2,1-2H3 |
| InChIKey | RQAGSTDFTGSIGB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Thamnosma rhodesica (ncbitaxon:675746) | Root (BTO:0001188) | PubMed (15081302) | |
| Ruta graveolens (ncbitaxon:37565) | Root (BTO:0001188) | PubMed (27272785) |
| Roles Classification |
|---|
| Biological Roles: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gravacridonediol (CHEBI:195185) has role antileishmanial agent (CHEBI:70868) |
| gravacridonediol (CHEBI:195185) has role plant metabolite (CHEBI:76924) |
| gravacridonediol (CHEBI:195185) is a acridone derivatives (CHEBI:61878) |
| gravacridonediol (CHEBI:195185) is a alkaloid (CHEBI:22315) |
| gravacridonediol (CHEBI:195185) is a cyclic ether (CHEBI:37407) |
| gravacridonediol (CHEBI:195185) is a organic heterotetracyclic compound (CHEBI:38163) |
| gravacridonediol (CHEBI:195185) is a primary alcohol (CHEBI:15734) |
| gravacridonediol (CHEBI:195185) is a tertiary alcohol (CHEBI:26878) |
| gravacridonediol (CHEBI:195185) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| 2-(1,2-dihydroxypropan-2-yl)-5-hydroxy-11-methyl-1,11-dihydrofuro[2,3-c]acridin-6(2H)-one |
| Synonyms | Source |
|---|---|
| 2-(1,2-dihydroxypropan-2-yl)-5-hydroxy-11-methyl-1,2-dihydrouro[2,3-c]acridin-6-one | SUBMITTER |
| gravacridondiol | ChEBI |
| 2-(1,2-dihydroxy-1-methylethyl)-1,11-dihydro-5-hydroxy-11-methylfuro[2,3-c]acridin-6(2H)-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029326 | HMDB |
| 4476568 | ChemSpider |
| C00050597 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:37551-75-0 | KNApSAcK |
| Citations |
|---|