EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O3 |
| Net Charge | 0 |
| Average Mass | 160.173 |
| Monoisotopic Mass | 160.08479 |
| SMILES | C[C@H]([NH3+])C(=O)N[C@@H](C)C(=O)[O-] |
| InChI | InChI=1S/C6H12N2O3/c1-3(7)5(9)8-4(2)6(10)11/h3-4H,7H2,1-2H3,(H,8,9)(H,10,11)/t3-,4-/m0/s1 |
| InChIKey | DEFJQIDDEAULHB-IMJSIDKUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Ala zwitterion (CHEBI:195181) is a dipeptide zwitterion (CHEBI:90799) |
| Ala-Ala zwitterion (CHEBI:195181) is tautomer of L-alanyl-L-alanine (CHEBI:72816) |
| Incoming Relation(s) |
| L-alanyl-L-alanine (CHEBI:72816) is tautomer of Ala-Ala zwitterion (CHEBI:195181) |
| IUPAC Name |
|---|
| (2S)-2-{[(2S)-2-azaniumylpropanoyl]amino}propanoate |
| Synonyms | Source |
|---|---|
| L-alanyl-L-alanine zwitterion | ChEBI |
| L-Ala-L-Ala zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| L-alanyl-L-alanine | UniProt |
| Citations |
|---|