EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:195173 - 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt)
| Formula | C6H15O3SSi.Na |
| Net Charge | 0 |
| Average Mass | 218.326 |
| Monoisotopic Mass | 218.04089 |
| SMILES | C[Si](C)(C)CCCS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H16O3SSi.Na/c1-11(2,3)6-4-5-10(7,8)9;/h4-6H2,1-3H3,(H,7,8,9);/q;+1/p-1 |
| InChIKey | HWEXKRHYVOGVDA-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| Application: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) (CHEBI:195173) has role NMR chemical shift reference compound (CHEBI:228364) |
| 1-Propanesulfonic acid, 3-(trimethylsilyl)- (sodium salt) (CHEBI:195173) is a organosulfonic acid (CHEBI:33551) |
| IUPAC Name |
|---|
| sodium;3-trimethylsilylpropane-1-sulonate |