EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O7P2 |
| Net Charge | 0 |
| Average Mass | 382.330 |
| Monoisotopic Mass | 382.13103 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C\COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C15H28O7P2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-21-24(19,20)22-23(16,17)18/h7,9,11H,5-6,8,10,12H2,1-4H3,(H,19,20)(H2,16,17,18)/b14-9+,15-11- |
| InChIKey | VWFJDQUYCIWHTN-PVMFERMNSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-cis,6-trans-farnesyl diphosphate (CHEBI:19515) is a farnesyl diphosphate (CHEBI:50277) |
| 2-cis,6-trans-farnesyl diphosphate (CHEBI:19515) is conjugate acid of 2-cis,6-trans-farnesyl diphosphate(3−) (CHEBI:162247) |
| Incoming Relation(s) |
| 2-cis,6-trans-farnesyl diphosphate(3−) (CHEBI:162247) is conjugate base of 2-cis,6-trans-farnesyl diphosphate (CHEBI:19515) |
| IUPAC Name |
|---|
| (2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl trihydrogen diphosphate |
| Synonym | Source |
|---|---|
| (2Z,6E)-Farnesyl diphosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C16826 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7861509 | Beilstein |