EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H5NO2S2 |
| Net Charge | 0 |
| Average Mass | 211.267 |
| Monoisotopic Mass | 210.97617 |
| SMILES | O=C(O)c1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C8H5NO2S2/c10-8(11)5-4-13-7(9-5)6-2-1-3-12-6/h1-4H,(H,10,11) |
| InChIKey | FGKCNTGJZXHKFJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-Thienyl)-1,3-thiazole-4-carboxylic acid (CHEBI:195101) is a aromatic carboxylic acid (CHEBI:33859) |
| 2-(2-Thienyl)-1,3-thiazole-4-carboxylic acid (CHEBI:195101) is a thiazoles (CHEBI:48901) |
| IUPAC Name |
|---|
| 2-thiophen-2-yl-1,3-thiazole-4-carboxylic acid |