EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5ClO2 |
| Net Charge | 0 |
| Average Mass | 156.568 |
| Monoisotopic Mass | 155.99781 |
| SMILES | O=C(O)c1ccccc1Cl |
| InChI | InChI=1S/C7H5ClO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10) |
| InChIKey | IKCLCGXPQILATA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | trunk bark (BTO:0001494) | PubMed (21312330) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-chlorobenzoic acid (CHEBI:30793) has role plant hormone (CHEBI:37848) |
| 2-chlorobenzoic acid (CHEBI:30793) has role plant metabolite (CHEBI:76924) |
| 2-chlorobenzoic acid (CHEBI:30793) is a 2-halobenzoic acid (CHEBI:70862) |
| 2-chlorobenzoic acid (CHEBI:30793) is a monochlorobenzoic acid (CHEBI:51967) |
| 2-chlorobenzoic acid (CHEBI:30793) is conjugate acid of 2-chlorobenzoate (CHEBI:28303) |
| Incoming Relation(s) |
| 2-chlorobenzoyl chloride (CHEBI:60719) has functional parent 2-chlorobenzoic acid (CHEBI:30793) |
| 2-chlorobenzoate (CHEBI:28303) is conjugate base of 2-chlorobenzoic acid (CHEBI:30793) |
| 2-chlorobenzoyl group (CHEBI:60718) is substituent group from 2-chlorobenzoic acid (CHEBI:30793) |
| IUPAC Name |
|---|
| 2-chlorobenzoic acid |
| Synonyms | Source |
|---|---|
| 2-Chlorobenzoic acid | KEGG COMPOUND |
| o-chlorobenzoic acid | NIST Chemistry WebBook |
| o-Chlorobenzoic acid | KEGG COMPOUND |
| Citations |
|---|