EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:19503 - propachlor
| Formula | C11H14ClNO |
| Net Charge | 0 |
| Average Mass | 211.692 |
| Monoisotopic Mass | 211.07639 |
| SMILES | CC(C)N(C(=O)CCl)c1ccccc1 |
| InChI | InChI=1S/C11H14ClNO/c1-9(2)13(11(14)8-12)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | MFOUDYKPLGXPGO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propachlor (CHEBI:19503) has role environmental contaminant (CHEBI:78298) |
| propachlor (CHEBI:19503) has role herbicide (CHEBI:24527) |
| propachlor (CHEBI:19503) has role xenobiotic (CHEBI:35703) |
| propachlor (CHEBI:19503) is a anilide (CHEBI:13248) |
| propachlor (CHEBI:19503) is a monocarboxylic acid amide (CHEBI:29347) |
| propachlor (CHEBI:19503) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 2-chloro-N-isopropyl-N-phenylacetamide |
| Synonyms | Source |
|---|---|
| 2-chloro-N-isopropylacetanilide | ChEBI |
| N-isopropyl-α-chloroacetanilide | UM-BBD |
| Chloressigsäure-N-isopropylanilid | ChemIDplus |
| 2-Chloro-N-(1-methylethyl)-N-phenylacetamide | ChemIDplus |
| alpha-Chloro-N-isopropylacetanilide | ChemIDplus |
| α-chloro-N-isopropylacetanilid | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| Kartex A | ChemIDplus |
| Ramrod 65 | ChemIDplus |
| Nitacid | ChemIDplus |
| Propachlore | ChemIDplus |
| Bexton 4L | ChemIDplus |
| Niticid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| c0653 | UM-BBD |
| Propachlor | Wikipedia |
| C18759 | KEGG COMPOUND |
| propachlor | Alan Wood's Pesticides |
| 543 | PPDB |
| Citations |
|---|