EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO2 |
| Net Charge | 0 |
| Average Mass | 175.187 |
| Monoisotopic Mass | 175.06333 |
| SMILES | COC(=O)c1ccc2nccc2c1 |
| InChI | InChI=1S/C10H9NO2/c1-13-10(12)8-2-3-9-7(6-8)4-5-11-9/h2-6,11H,1H3 |
| InChIKey | DRYBMFJLYYEOBZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl indole-5-carboxylate (CHEBI:194927) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| methyl 1H-indole-5-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 2019267 | ChemSpider |