EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O3S |
| Net Charge | 0 |
| Average Mass | 158.178 |
| Monoisotopic Mass | 158.00377 |
| SMILES | COc1cscc1C(=O)O |
| InChI | InChI=1S/C6H6O3S/c1-9-5-3-10-2-4(5)6(7)8/h2-3H,1H3,(H,7,8) |
| InChIKey | KEYPLCJVNVJJQK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Methoxythiophene-3-carboxylic acid (CHEBI:194869) is a thiophenecarboxylic acid (CHEBI:48436) |
| IUPAC Name |
|---|
| 4-methoxythiophene-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 2058635 | ChemSpider |