EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7ClO2S |
| Net Charge | 0 |
| Average Mass | 190.651 |
| Monoisotopic Mass | 189.98553 |
| SMILES | COC(=O)c1scc(C)c1Cl |
| InChI | InChI=1S/C7H7ClO2S/c1-4-3-11-6(5(4)8)7(9)10-2/h3H,1-2H3 |
| InChIKey | BUFSIDWTJVUAER-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl 3-chloro-4-methylthiophene-2-carboxylate (CHEBI:194860) is a thiophenecarboxylic acid (CHEBI:48436) |
| IUPAC Name |
|---|
| methyl 3-chloro-4-methylthiophene-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 2057845 | ChemSpider |