EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O5 |
| Net Charge | 0 |
| Average Mass | 238.239 |
| Monoisotopic Mass | 238.08412 |
| SMILES | COC(=O)/C=C/c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C12H14O5/c1-15-9-6-8(4-5-11(13)17-3)7-10(16-2)12(9)14/h4-7,14H,1-3H3/b5-4+ |
| InChIKey | JHLPYWLKSLVYOI-SNAWJCMRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl-sinapate (CHEBI:194845) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| methyl (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 4479104 | ChemSpider |