EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13NO2 |
| Net Charge | 0 |
| Average Mass | 203.241 |
| Monoisotopic Mass | 203.09463 |
| SMILES | CCCCC#Cc1cncc(C(=O)O)c1 |
| InChI | InChI=1S/C12H13NO2/c1-2-3-4-5-6-10-7-11(12(14)15)9-13-8-10/h7-9H,2-4H2,1H3,(H,14,15) |
| InChIKey | FKWDNFDBDZUPIQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Hex-1-ynylnicotinic acid (CHEBI:194824) is a aromatic carboxylic acid (CHEBI:33859) |
| 5-Hex-1-ynylnicotinic acid (CHEBI:194824) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 5-hex-1-ynylpyridine-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 2018182 | ChemSpider |