EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:194810 - 5-Fluoroindole-3-acetic acid
| Formula | C10H8FNO2 |
| Net Charge | 0 |
| Average Mass | 193.177 |
| Monoisotopic Mass | 193.05391 |
| SMILES | O=C(O)Cc1cnc2ccc(F)cc12 |
| InChI | InChI=1S/C10H8FNO2/c11-7-1-2-9-8(4-7)6(5-12-9)3-10(13)14/h1-2,4-5,12H,3H2,(H,13,14) |
| InChIKey | GWLLOJBOPVNWNF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Fluoroindole-3-acetic acid (CHEBI:194810) is a indole-3-acetic acids (CHEBI:24803) |
| IUPAC Name |
|---|
| 2-(5-luoro-1H-indol-3-yl)acetic acid |