EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H6O3S |
| Net Charge | 0 |
| Average Mass | 194.211 |
| Monoisotopic Mass | 194.00377 |
| SMILES | O=C(O)c1ccc(-c2ccco2)s1 |
| InChI | InChI=1S/C9H6O3S/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h1-5H,(H,10,11) |
| InChIKey | ZASUJVQPFQRFPQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(2-Furyl)thiophene-2-carboxylic acid (CHEBI:194790) is a thiophenecarboxylic acid (CHEBI:48436) |
| IUPAC Name |
|---|
| 5-(uran-2-yl)thiophene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 1547265 | ChemSpider |