EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO2S |
| Net Charge | 0 |
| Average Mass | 183.232 |
| Monoisotopic Mass | 183.03540 |
| SMILES | CCSc1ncccc1C(=O)O |
| InChI | InChI=1S/C8H9NO2S/c1-2-12-7-6(8(10)11)4-3-5-9-7/h3-5H,2H2,1H3,(H,10,11) |
| InChIKey | LYHPPDODTUEXAN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(Ethylthio)nicotinic acid (CHEBI:194776) is a aromatic carboxylic acid (CHEBI:33859) |
| 2-(Ethylthio)nicotinic acid (CHEBI:194776) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 2-ethylsulanylpyridine-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 514410 | ChemSpider |