EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8ClNO2S |
| Net Charge | 0 |
| Average Mass | 205.666 |
| Monoisotopic Mass | 204.99643 |
| SMILES | CCOC(=O)c1sc(Cl)nc1C |
| InChI | InChI=1S/C7H8ClNO2S/c1-3-11-6(10)5-4(2)9-7(8)12-5/h3H2,1-2H3 |
| InChIKey | VUARUZUFHDNJSY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ethyl 2-chloro-4-methyl-1,3-thiazole-5-carboxylate (CHEBI:194772) is a aromatic carboxylic acid (CHEBI:33859) |
| Ethyl 2-chloro-4-methyl-1,3-thiazole-5-carboxylate (CHEBI:194772) is a thiazoles (CHEBI:48901) |
| IUPAC Name |
|---|
| ethyl 2-chloro-4-methyl-1,3-thiazole-5-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 517160 | ChemSpider |