EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15NO2S |
| Net Charge | 0 |
| Average Mass | 237.324 |
| Monoisotopic Mass | 237.08235 |
| SMILES | C#CC(CC)(CC)Nc1ccsc1C(=O)O |
| InChI | InChI=1S/C12H15NO2S/c1-4-12(5-2,6-3)13-9-7-8-16-10(9)11(14)15/h1,7-8,13H,5-6H2,2-3H3,(H,14,15) |
| InChIKey | IJNZNXQLANOYJT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[(1,1-Diethylprop-2-ynyl)amino]thiophene-2-carboxylic acid (CHEBI:194765) is a thiophenecarboxylic acid (CHEBI:48436) |
| IUPAC Name |
|---|
| 3-(3-ethylpent-1-yn-3-ylamino)thiophene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 2021718 | ChemSpider |