EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15NO2.HCl |
| Net Charge | 0 |
| Average Mass | 229.707 |
| Monoisotopic Mass | 229.08696 |
| SMILES | COc1cc2c(cc1OC)CNCC2.Cl |
| InChI | InChI=1S/C11H15NO2.ClH/c1-13-10-5-8-3-4-12-7-9(8)6-11(10)14-2;/h5-6,12H,3-4,7H2,1-2H3;1H |
| InChIKey | SHOWAGCIRTUYNA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mitrocereus militaris (ncbitaxon:223066) | - | PubMed (7354455) | Species also known as Backebergia Militaris. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heliamine hydrochloride (CHEBI:194745) has part heliamine(1+) (CHEBI:194515) |
| heliamine hydrochloride (CHEBI:194745) has role plant metabolite (CHEBI:76924) |
| heliamine hydrochloride (CHEBI:194745) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride |
| Synonyms | Source |
|---|---|
| 1,2,3,4-tetrahydro-6,7-dimethoxyisoquinoline hydrochloride | ChEBI |
| 6,7-bis(methyloxy)-1,2,3,4-tetrahydroisoquinoline hydrochloride | ChEBI |
| 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium chloride | ChEBI |
| 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride (1:1) | ChEBI |
| 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline monohydrochloride | ChEBI |
| 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolinium chloride | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 15973 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3634126 | Reaxys |
| CAS:2328-12-3 | ChEBI |
| Citations |
|---|