EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H3Cl2NO2 |
| Net Charge | 0 |
| Average Mass | 192.001 |
| Monoisotopic Mass | 190.95408 |
| SMILES | O=C(O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C6H3Cl2NO2/c7-4-2-1-3(6(10)11)5(8)9-4/h1-2H,(H,10,11) |
| InChIKey | AJPKQSSFYHPYMH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-Dichloronicotinic acid (CHEBI:194742) is a aromatic carboxylic acid (CHEBI:33859) |
| 2,6-Dichloronicotinic acid (CHEBI:194742) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 2,6-dichloropyridine-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 746430 | ChemSpider |