EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7NO2S |
| Net Charge | 0 |
| Average Mass | 157.194 |
| Monoisotopic Mass | 157.01975 |
| SMILES | Cc1nc(C)c(C(=O)O)s1 |
| InChI | InChI=1S/C6H7NO2S/c1-3-5(6(8)9)10-4(2)7-3/h1-2H3,(H,8,9) |
| InChIKey | MQGBARXPCXAFRZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-Dimethyl-1,3-thiazole-5-carboxylic acid (CHEBI:194729) is a aromatic carboxylic acid (CHEBI:33859) |
| 2,4-Dimethyl-1,3-thiazole-5-carboxylic acid (CHEBI:194729) is a thiazoles (CHEBI:48901) |
| IUPAC Name |
|---|
| 2,4-dimethyl-1,3-thiazole-5-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 643611 | ChemSpider |