EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO4 |
| Net Charge | 0 |
| Average Mass | 147.130 |
| Monoisotopic Mass | 147.05316 |
| SMILES | C[C@H](C(=O)O)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C5H9NO4/c1-2(4(7)8)3(6)5(9)10/h2-3H,6H2,1H3,(H,7,8)(H,9,10)/t2-,3+/m0/s1 |
| InChIKey | LXRUAYBIUSUULX-STHAYSLISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DL-threo-beta-Methylaspartate (CHEBI:194704) is a D-α-amino acid (CHEBI:16733) |
| IUPAC Name |
|---|
| (2R,3S)-2-amino-3-methylbutanedioic acid |
| Synonym | Source |
|---|---|
| threo-beta-methylaspartate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4449932 | ChemSpider |