EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7NO2 |
| Net Charge | 0 |
| Average Mass | 113.116 |
| Monoisotopic Mass | 113.04768 |
| SMILES | O=C(O)[C@@H]1C=CCN1 |
| InChI | InChI=1S/C5H7NO2/c7-5(8)4-2-1-3-6-4/h1-2,4,6H,3H2,(H,7,8)/t4-/m0/s1 |
| InChIKey | OMGHIGVFLOPEHJ-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dehydro-proline (CHEBI:194703) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2,5-dihydro-1H-pyrrole-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 85089 | ChemSpider |