EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5NO2S2 |
| Net Charge | 0 |
| Average Mass | 199.256 |
| Monoisotopic Mass | 198.97617 |
| SMILES | CSc1sc(C(=O)O)cc1C#N |
| InChI | InChI=1S/C7H5NO2S2/c1-11-7-4(3-8)2-5(12-7)6(9)10/h2H,1H3,(H,9,10) |
| InChIKey | YRDBBAGWMJGPKF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Cyano-5-methylsulfanylthiophene-2-carboxylic acid (CHEBI:194697) is a thiophenecarboxylic acid (CHEBI:48436) |
| IUPAC Name |
|---|
| 4-cyano-5-methylsulanylthiophene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 25077132 | ChemSpider |