EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H3ClF3NO2 |
| Net Charge | 0 |
| Average Mass | 225.553 |
| Monoisotopic Mass | 224.98044 |
| SMILES | O=C(O)c1cc(C(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C7H3ClF3NO2/c8-5-2-3(7(9,10)11)1-4(12-5)6(13)14/h1-2H,(H,13,14) |
| InChIKey | TVUNLKOAOAHOBJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-Chloro-4-(trifluoromethyl)pyridine-2-carboxylic acid (CHEBI:194691) is a aromatic carboxylic acid (CHEBI:33859) |
| 6-Chloro-4-(trifluoromethyl)pyridine-2-carboxylic acid (CHEBI:194691) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 6-chloro-4-(triluoromethyl)pyridine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 19894436 | ChemSpider |