EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6ClNO2 |
| Net Charge | 0 |
| Average Mass | 171.583 |
| Monoisotopic Mass | 171.00871 |
| SMILES | Cc1cc(C(=O)O)cc(Cl)n1 |
| InChI | InChI=1S/C7H6ClNO2/c1-4-2-5(7(10)11)3-6(8)9-4/h2-3H,1H3,(H,10,11) |
| InChIKey | ZGZMEKHQIZSZOH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Chloro-6-methylisonicotinic acid (CHEBI:194645) is a aromatic carboxylic acid (CHEBI:33859) |
| 2-Chloro-6-methylisonicotinic acid (CHEBI:194645) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 2-chloro-6-methylpyridine-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 124558 | ChemSpider |