EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | CC(=O)CC(N)C(=O)O |
| InChI | InChI=1S/C5H9NO3/c1-3(7)2-4(6)5(8)9/h4H,2,6H2,1H3,(H,8,9) |
| InChIKey | QUCHWTCTBHQQDU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-4-oxopentanoic acid (CHEBI:15914) has functional parent valeric acid (CHEBI:17418) |
| 2-amino-4-oxopentanoic acid (CHEBI:15914) is a 4-oxo monocarboxylic acid (CHEBI:35950) |
| 2-amino-4-oxopentanoic acid (CHEBI:15914) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 2-amino-4-oxopentanoic acid (CHEBI:15914) is tautomer of 2-amino-4-oxopentanoic acid zwitterion (CHEBI:57563) |
| Incoming Relation(s) |
| (R)-2-amino-4-oxopentanoic acid (CHEBI:136679) is a 2-amino-4-oxopentanoic acid (CHEBI:15914) |
| 2-amino-4-oxopentanoic acid zwitterion (CHEBI:57563) is tautomer of 2-amino-4-oxopentanoic acid (CHEBI:15914) |
| IUPAC Name |
|---|
| 2-amino-4-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| 2-Amino-4-oxopentanoate | KEGG COMPOUND |
| 2-Amino-4-oxopentanoate | KEGG COMPOUND |
| 2-Amino-4-oxopentanoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03341 | KEGG COMPOUND |
| C03341 | KEGG COMPOUND |
| LMFA01060171 | LIPID MAPS |