EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | CC(=O)C[C@@H](N)C(=O)O |
| InChI | InChI=1S/C5H9NO3/c1-3(7)2-4(6)5(8)9/h4H,2,6H2,1H3,(H,8,9)/t4-/m1/s1 |
| InChIKey | QUCHWTCTBHQQDU-SCSAIBSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-amino-4-oxopentanoic acid (CHEBI:136679) is a D-alanine derivative (CHEBI:83944) |
| (R)-2-amino-4-oxopentanoic acid (CHEBI:136679) is a 2-amino-4-oxopentanoic acid (CHEBI:15914) |
| (R)-2-amino-4-oxopentanoic acid (CHEBI:136679) is tautomer of (R)-2-amino-4-oxopentanoic acid zwitterion (CHEBI:134102) |
| Incoming Relation(s) |
| (R)-2-amino-4-oxopentanoic acid zwitterion (CHEBI:134102) is tautomer of (R)-2-amino-4-oxopentanoic acid (CHEBI:136679) |
| IUPAC Name |
|---|
| 4-oxo-D-norvaline |
| Synonyms | Source |
|---|---|
| 3-acetyl-D-alanine | ChEBI |
| β-acetyl-D-alanine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-299 | MetaCyc |