EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O3S2 |
| Net Charge | 0 |
| Average Mass | 230.310 |
| Monoisotopic Mass | 230.00714 |
| SMILES | CSc1sc(C(=O)O)c(C)c1C(C)=O |
| InChI | InChI=1S/C9H10O3S2/c1-4-6(5(2)10)9(13-3)14-7(4)8(11)12/h1-3H3,(H,11,12) |
| InChIKey | KEWQKVSPZZSZNE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Acetyl-3-methyl-5-(methylthio)thiophene-2-carboxylic acid (CHEBI:194605) is a thiophenecarboxylic acid (CHEBI:48436) |
| IUPAC Name |
|---|
| 4-acetyl-3-methyl-5-methylsulanylthiophene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 630112 | ChemSpider |