EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27NO5 |
| Net Charge | 0 |
| Average Mass | 385.460 |
| Monoisotopic Mass | 385.18892 |
| SMILES | COc1cc2c(cc1OC)C(=O)Cc1ccc(OC)c(OC)c1CN(C)CC2 |
| InChI | InChI=1S/C22H27NO5/c1-23-9-8-15-11-20(26-3)21(27-4)12-16(15)18(24)10-14-6-7-19(25-2)22(28-5)17(14)13-23/h6-7,11-12H,8-10,13H2,1-5H3 |
| InChIKey | HUIJAZQRYSCNED-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Argemone squarrosa (ncbitaxon:99331) | - | PubMed (6034814) | |
| Corydalis decumbens (ncbitaxon:38904) | rhizome (BTO:0001181) | Article (Jing Liao, Wen-Zao Liang, Guo-Shi Tu. Isolation and Identification of Eleven Tertiary Alkaloidsin Corydalis decumbens. Journal of Chinese Pharmaceutical Sciences, 01 Jan 1995, 4(2), 57-6.) | |
| Glaucium vitellinum (IPNI:673209-1) | - | PubMed (19671) | |
| Papaver nudicaule (ncbitaxon:74823) | aerial part (BTO:0001658) | PubMed (32517053) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| muramine (CHEBI:194523) has role plant metabolite (CHEBI:76924) |
| muramine (CHEBI:194523) is a aromatic ether (CHEBI:35618) |
| muramine (CHEBI:194523) is a dibenzazecine alkaloid (CHEBI:38608) |
| muramine (CHEBI:194523) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 3,4,10,11-tetramethoxy-6-methyl-5,7,8,14-tetrahydrodibenzo[c,g]azecin-13(6H)-one |
| Synonyms | Source |
|---|---|
| 5,7,8,14-tetrahydro-3,4,10,11-tetramethoxy-6-methyldibenz[c,g]azecin-13(6H)-one | ChEBI |
| cryptopalmatine | ChEBI |
| UniProt Name | Source |
|---|---|
| muramine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00028614 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:2292-20-8 | KNApSAcK |
| Citations |
|---|