EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7N3O4 |
| Net Charge | 0 |
| Average Mass | 197.150 |
| Monoisotopic Mass | 197.04366 |
| SMILES | Cc1c(N)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7N3O4/c1-4-6(8)2-5(9(11)12)3-7(4)10(13)14/h2-3H,8H2,1H3 |
| InChIKey | IEEJAAUSLQCGJH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | explosive A substance capable of undergoing rapid and highly exothermic decomposition. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | fungal xenobiotic metabolite Any fungal metabolite produced by metabolism of a xenobiotic compound in fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-4,6-dinitrotoluene (CHEBI:19452) has role explosive (CHEBI:63490) |
| 2-amino-4,6-dinitrotoluene (CHEBI:19452) has role fungal xenobiotic metabolite (CHEBI:76968) |
| 2-amino-4,6-dinitrotoluene (CHEBI:19452) is a amino-nitrotoluene (CHEBI:22482) |
| IUPAC Name |
|---|
| 2-methyl-3,5-dinitroaniline |
| Synonyms | Source |
|---|---|
| 2,4-Dinitro-6-aminotoluene | NIST Chemistry WebBook |
| 2-Adnt | NIST Chemistry WebBook |
| 2-Methyl-3,5-dinitrobenzenamine | ChemIDplus |
| 3,5-Dinitro-o-toluidine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2-amino-4,6-dinitrotoluene | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2377515 | Reaxys |
| CAS:35572-78-2 | NIST Chemistry WebBook |
| CAS:35572-78-2 | KEGG COMPOUND |
| CAS:35572-78-2 | ChemIDplus |
| Citations |
|---|