EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | CC1=C[C@H](O/C=C(C)\C=C\C2=C(C)CCCC2(C)C)OC1=O |
| InChI | InChI=1S/C19H26O3/c1-13(12-21-17-11-15(3)18(20)22-17)8-9-16-14(2)7-6-10-19(16,4)5/h8-9,11-12,17H,6-7,10H2,1-5H3/b9-8+,13-12-/t17-/m1/s1 |
| InChIKey | OTIYLZVFQIMLQH-UIUAQFKNSA-N |
| Roles Classification |
|---|
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (11R)-carlactone (CHEBI:194508) is a carlactone (CHEBI:67190) |
| Incoming Relation(s) |
| (11R)-19-hydroxycarlactone (CHEBI:194510) has functional parent (11R)-carlactone (CHEBI:194508) |
| (11R)-19-oxocarlactone (CHEBI:194511) has functional parent (11R)-carlactone (CHEBI:194508) |
| UniProt Name | Source |
|---|---|
| (11R)-carlactone | UniProt |
| Citations |
|---|