EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO4 |
| Net Charge | 0 |
| Average Mass | 313.353 |
| Monoisotopic Mass | 313.13141 |
| SMILES | [H][C@@]12Cc3ccc(OC)c(O)c3CN1CCc1cc(O)c(O)cc12 |
| InChI | InChI=1S/C18H19NO4/c1-23-17-3-2-10-6-14-12-8-16(21)15(20)7-11(12)4-5-19(14)9-13(10)18(17)22/h2-3,7-8,14,20-22H,4-6,9H2,1H3/t14-/m0/s1 |
| InChIKey | WDZUKYLSGVBAHN-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3-O-demethylscoulerine (CHEBI:194500) is a berberine alkaloid (CHEBI:22754) |
| (S)-3-O-demethylscoulerine (CHEBI:194500) is a organic heterotetracyclic compound (CHEBI:38163) |
| UniProt Name | Source |
|---|---|
| (S)-3-O-demethylscoulerine | UniProt |
| Citations |
|---|