EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3 |
| Net Charge | 0 |
| Average Mass | 145.158 |
| Monoisotopic Mass | 145.07389 |
| SMILES | CC(=O)CCC(N)C(=O)O |
| InChI | InChI=1S/C6H11NO3/c1-4(8)2-3-5(7)6(9)10/h5H,2-3,7H2,1H3,(H,9,10) |
| InChIKey | KSIJECNNZVKMJG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-5-oxohexanoic acid (CHEBI:19450) has functional parent hexanoic acid (CHEBI:30776) |
| 2-amino-5-oxohexanoic acid (CHEBI:19450) is a 5-oxo monocarboxylic acid (CHEBI:35952) |
| 2-amino-5-oxohexanoic acid (CHEBI:19450) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 2-amino-5-oxohexanoic acid (CHEBI:19450) is conjugate acid of 2-amino-5-oxohexanoate (CHEBI:1010) |
| Incoming Relation(s) |
| 2-amino-5-oxohexanoate (CHEBI:1010) is conjugate base of 2-amino-5-oxohexanoic acid (CHEBI:19450) |
| IUPAC Name |
|---|
| 2-amino-5-oxohexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C05825 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:24438-52-6 | ChEBI |