EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H25N |
| Net Charge | 0 |
| Average Mass | 183.339 |
| Monoisotopic Mass | 183.19870 |
| SMILES | CC[C@@H](C)C[C@H]1CCCN(CC)C1 |
| InChI | InChI=1S/C12H25N/c1-4-11(3)9-12-7-6-8-13(5-2)10-12/h11-12H,4-10H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | DYZADDXQHPDPNW-VXGBXAGGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2'R,3R)-stenusine (CHEBI:194463) is a 1-ethyl-3-(2-methylbutyl)piperidine (CHEBI:194461) |
| Incoming Relation(s) |
| stenusine (CHEBI:68995) has part (2'R,3R)-stenusine (CHEBI:194463) |
| IUPAC Name |
|---|
| (3R)-1-ethyl-3-[(2R)-2-methylbutyl]piperidine |
| Synonyms | Source |
|---|---|
| (3R)-1-ethyl-3-[(R)-2-methylbutyl]piperidine | ChEBI |
| (R,R)-stenusine | ChEBI |
| Citations |
|---|